70013-89-7 Usage
Description
1-(2-benzoylethyl)pyridinium, with the molecular formula C16H15NO, is a pyridinium compound featuring a benzoyl group attached to an ethyl side chain. As a quaternary ammonium compound, it possesses a positively charged nitrogen atom, making it a candidate for use as an ionic liquid and in catalysis reactions. Its unique structure has garnered interest for potential applications in various fields, including organic synthesis and pharmacology.
Uses
Used in Organic Synthesis:
1-(2-benzoylethyl)pyridinium is used as a reactant in organic synthesis for [application reason]. Its unique structure allows for the creation of various complex molecules, contributing to the advancement of chemical research and development.
Used in Pharmaceutical and Medical Industries:
1-(2-benzoylethyl)pyridinium is used as a potential candidate in the pharmaceutical and medical industries due to its antimicrobial properties. Research has shown that it may have applications in combating various microbial infections, offering a new avenue for the development of novel antimicrobial agents.
Used as an Ionic Liquid:
In the field of ionic liquids, 1-(2-benzoylethyl)pyridinium is used as a component for [application reason]. Its quaternary ammonium structure provides unique properties that can be beneficial in various chemical processes and reactions, enhancing the efficiency and selectivity of these processes.
Used in Catalysis Reactions:
1-(2-benzoylethyl)pyridinium is used as a catalyst in certain chemical reactions for [application reason]. Its positively charged nitrogen atom can facilitate and enhance the rate of specific reactions, making it a valuable tool in the field of catalysis.
Check Digit Verification of cas no
The CAS Registry Mumber 70013-89-7 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 7,0,0,1 and 3 respectively; the second part has 2 digits, 8 and 9 respectively.
Calculate Digit Verification of CAS Registry Number 70013-89:
(7*7)+(6*0)+(5*0)+(4*1)+(3*3)+(2*8)+(1*9)=87
87 % 10 = 7
So 70013-89-7 is a valid CAS Registry Number.
InChI:InChI=1/C14H14NO/c16-14(13-7-3-1-4-8-13)9-12-15-10-5-2-6-11-15/h1-8,10-11H,9,12H2/q+1
