71556-73-5 Usage
General Description
3-ethylhexahydro-3-(3-methoxyphenyl)-1-methyl-1H-azepine is a chemical compound with a complex molecular structure. It belongs to the class of azepine compounds and contains an ethyl group, a methyl group, and a methoxyphenyl group attached to a central 1H-azepine ring. 3-ethylhexahydro-3-(3-methoxyphenyl)-1-methyl-1H-azepine is used in organic synthesis and drug development, and its unique structure gives it potential pharmacological properties. Its synthesis and properties make it an interesting compound for research and potential applications in the pharmaceutical industry.
Check Digit Verification of cas no
The CAS Registry Mumber 71556-73-5 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 7,1,5,5 and 6 respectively; the second part has 2 digits, 7 and 3 respectively.
Calculate Digit Verification of CAS Registry Number 71556-73:
(7*7)+(6*1)+(5*5)+(4*5)+(3*6)+(2*7)+(1*3)=135
135 % 10 = 5
So 71556-73-5 is a valid CAS Registry Number.
InChI:InChI=1/C16H25NO/c1-4-16(10-5-6-11-17(2)13-16)14-8-7-9-15(12-14)18-3/h7-9,12H,4-6,10-11,13H2,1-3H3
