7189-06-2 Usage
Description
(1,3-diphenyl-1H-pyrazol-4-yl)(phenyl)methanone is a chemical compound belonging to the class of pyrazoles and featuring a ketone group. It has a molecular formula of C21H15N2O and a molecular weight of 313.35 g/mol. (1,3-diphenyl-1H-pyrazol-4-yl)(phenyl)methanone is characterized by its unique chemical structure and potential biological activities, making it a promising candidate for organic synthesis and pharmaceutical research.
Uses
Used in Organic Synthesis:
(1,3-diphenyl-1H-pyrazol-4-yl)(phenyl)methanone is used as a key intermediate in organic synthesis for the development of various chemical compounds. Its unique structure allows for versatile reactions and the formation of a wide range of products.
Used in Pharmaceutical Research:
In the pharmaceutical industry, (1,3-diphenyl-1H-pyrazol-4-yl)(phenyl)methanone is used as a starting material for the design and synthesis of new drugs. Its potential biological activities and interesting chemical properties make it a valuable target for medicinal chemistry and drug discovery efforts.
Used in Medicinal Chemistry:
(1,3-diphenyl-1H-pyrazol-4-yl)(phenyl)methanone is employed as a building block in medicinal chemistry for the creation of novel therapeutic agents. Its unique structure and potential interactions with biological targets make it a promising candidate for the development of new pharmaceuticals.
Used in Drug Discovery:
In the field of drug discovery, (1,3-diphenyl-1H-pyrazol-4-yl)(phenyl)methanone is utilized for the identification and optimization of lead compounds. Its unique chemical properties and potential biological activities contribute to the advancement of new drug candidates for various therapeutic applications.
Check Digit Verification of cas no
The CAS Registry Mumber 7189-06-2 includes 7 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 4 digits, 7,1,8 and 9 respectively; the second part has 2 digits, 0 and 6 respectively.
Calculate Digit Verification of CAS Registry Number 7189-06:
(6*7)+(5*1)+(4*8)+(3*9)+(2*0)+(1*6)=112
112 % 10 = 2
So 7189-06-2 is a valid CAS Registry Number.
InChI:InChI=1/C22H16N2O/c25-22(18-12-6-2-7-13-18)20-16-24(19-14-8-3-9-15-19)23-21(20)17-10-4-1-5-11-17/h1-16H
7189-06-2Relevant articles and documents
Enaminones in the synthesis of heterocycles by microwave irradiation
Al-Shiekh, Mariam A.
, p. 223 - 230 (2005)
-
Antispasmodic and antimicrobial activities of pyrazole-containing ferrocenyl alkanols versus their phenyl analogs, and the entry point to potential multitarget treatment for inflammatory bowel diseases
Radulovi?, Niko S.,Nikoli?, Milica G.,Mladenovi?, Marko Z.,Ran?elovi?, Pavle,Stojanovi?, Nikola M.,Stojanovi?-Radi?, Zorica,Jovanovi?, Ljiljana
, (2021/11/23)
Inflammatory bowel diseases (IBM), such as Crohn's disease, and their common complications represent a global health challenge. Many pyrazole derivatives, such as the spasmolytic drug metamizole, have already found their place among the frequently used th
Copper-Catalyzed Synthesis of Substituted 4-Acylpyrazole Derivatives through a Cascade Transformation from N-Propargylic Sulfonylhydrazones and Diaryliodonium Salts
Li, Ren-Hao,Fan, Xin-Yang,Hu, Zi-Lin,Liu, Zhi-Kai,Yang, Ying,Tang, Hai-Tao,Chen, Yi-Hui,Chen, Li,Zhan, Zhuang-Ping
supporting information, p. 2283 - 2287 (2018/10/20)
A concise strategy for the synthesis of substituted 4-acylpyrazole derivatives from N-propargylic sulfonylhydrazones and diaryliodonium salts has been developed. The pyrazole derivatives are formed through a five-step cascade sequence that includes intramolecular cyclization, hydroxylation, elimination, copper-catalyzed aerobic oxidation, and intramolecular rearrangement.