74420-02-3 Usage
Description
4-HYDROXY-7-AZAINDOLE, also known as 1H-Pyrrolo[2,3-b]pyridin-4-ol, is a tan solid with unique chemical properties. It is a high-performance polyazaindole that has gained significant attention for its potential applications in various fields due to its novel acid fluorescent sensor capabilities and its role as a reactant in the synthesis of potent and selective inhibitors.
Uses
Used in Chemical Sensing Applications:
4-HYDROXY-7-AZAINDOLE is used as a high-performance polyazaindole for its novel acid fluorescent sensor with a tunable ICT (Intramolecular Charge Transfer) effect. This characteristic makes it a valuable compound for detecting and monitoring various chemical species, contributing to advancements in chemical sensing technology.
Used in Pharmaceutical Industry:
4-HYDROXY-7-AZAINDOLE is used as a reactant in the design and synthesis of potent and selective azaindole-based Rho kinase (ROCK) inhibitors. These inhibitors play a crucial role in the development of new therapeutic strategies for various diseases, as they target specific protein kinases involved in cellular signaling pathways, potentially leading to more effective treatments with fewer side effects.
Check Digit Verification of cas no
The CAS Registry Mumber 74420-02-3 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 7,4,4,2 and 0 respectively; the second part has 2 digits, 0 and 2 respectively.
Calculate Digit Verification of CAS Registry Number 74420-02:
(7*7)+(6*4)+(5*4)+(4*2)+(3*0)+(2*0)+(1*2)=103
103 % 10 = 3
So 74420-02-3 is a valid CAS Registry Number.
InChI:InChI=1/C7H6N2O/c10-6-2-4-9-7-5(6)1-3-8-7/h1-4H,(H2,8,9,10)
74420-02-3Relevant articles and documents
Concise and Efficient Synthesis of 4-Fluoro-1H-pyrrolo[2,3-b]pyridine
Thibault, Carl,L'Heureux, Alexandre,Bhide, Rajeev S.,Ruel, Rejean
, p. 5023 - 5025 (2007/10/03)
(Equation presented) Two routes describing the preparation of 4-fluoro-1H-pyrrolo[2,3-b]pyridine (4a) from 1H-pyrrolo[2,3-b]pyridine N-oxide (1) are presented. Regioselective fluorination was achieved using either the Balz-Schiemann reaction or lithium-halogen exchange.
