74436-00-3 Usage
Description
Geclosporin G is a derivative of Cyclosporin A, which is a nonpolar cyclic oligopeptide known for its immunosuppressive properties. It has played a significant role in the field of organ transplantation by effectively preventing graft rejection.
Uses
Used in Organ Transplantation:
Geclosporin G is used as an immunosuppressant in the organ transplantation industry to prevent graft rejection. Its immunosuppressive activity helps in reducing the risk of the recipient's immune system attacking the transplanted organ, thus increasing the chances of a successful transplant.
Used in Pharmaceutical Industry:
Geclosporin G is also used in the pharmaceutical industry as a key component in the development of drugs that target the immune system. Its immunosuppressive properties make it a valuable asset in the treatment of various autoimmune diseases and conditions where the immune system is overactive or needs to be regulated.
Check Digit Verification of cas no
The CAS Registry Mumber 74436-00-3 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 7,4,4,3 and 6 respectively; the second part has 2 digits, 0 and 0 respectively.
Calculate Digit Verification of CAS Registry Number 74436-00:
(7*7)+(6*4)+(5*4)+(4*3)+(3*6)+(2*0)+(1*0)=123
123 % 10 = 3
So 74436-00-3 is a valid CAS Registry Number.
InChI:InChI=1/C63H113N11O12/c1-25-27-29-41(15)53(76)52-57(80)66-44(28-26-2)59(82)68(18)34-49(75)69(19)45(30-35(3)4)56(79)67-50(39(11)12)62(85)70(20)46(31-36(5)6)55(78)64-42(16)54(77)65-43(17)58(81)71(21)47(32-37(7)8)60(83)72(22)48(33-38(9)10)61(84)73(23)51(40(13)14)63(86)74(52)24/h25,27,35-48,50-53,76H,26,28-34H2,1-24H3,(H,64,78)(H,65,77)(H,66,80)(H,67,79)/b27-25+