84-43-5 Usage
General Description
2-hydroxy-11H-benzo[a]carbazole-3-carboxylic acid is a chemical compound that belongs to the class of carbazole derivatives. It is characterized by a hydroxyl group attached to the carbon 2 of the carbazole ring, and a carboxylic acid group attached to the carbon 3. 2-hydroxy-11H-benzo[a]carbazole-3-carboxylic acid has potential applications in pharmaceuticals and medicinal chemistry due to its unique structure and potential biological activities. It may also have uses in organic synthesis and material science due to its aromatic and functional group properties. Further research and study are needed to fully understand the potential applications and properties of 2-hydroxy-11H-benzo[a]carbazole-3-carboxylic acid.
Check Digit Verification of cas no
The CAS Registry Mumber 84-43-5 includes 5 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 2 digits, 8 and 4 respectively; the second part has 2 digits, 4 and 3 respectively.
Calculate Digit Verification of CAS Registry Number 84-43:
(4*8)+(3*4)+(2*4)+(1*3)=55
55 % 10 = 5
So 84-43-5 is a valid CAS Registry Number.
InChI:InChI=1/C17H11NO3/c19-15-8-12-9(7-13(15)17(20)21)5-6-11-10-3-1-2-4-14(10)18-16(11)12/h1-8,18-19H,(H,20,21)