89466-07-9 Usage
Description
4-Amino-3-nitrophenylboronic acid is a synthetic building block characterized by the presence of an amino group, a nitro group, and a boronic acid moiety attached to a phenyl ring. It is utilized in various chemical reactions and synthesis processes, particularly in the field of organic chemistry.
Uses
Used in Organic Synthesis:
4-Amino-3-nitrophenylboronic acid is used as a reactant for the preparation of various organic compounds through coupling reactions. Its boronic acid group allows it to participate in metal-catalyzed Suzuki coupling reactions, which are widely used for the formation of carbon-carbon bonds.
Used in Pharmaceutical Industry:
In the pharmaceutical industry, 4-Amino-3-nitrophenylboronic acid is used as a building block for the synthesis of complex organic molecules, including potential drug candidates. Its versatility in coupling reactions enables the creation of diverse molecular structures with potential therapeutic applications.
Used in Chemical Research:
4-Amino-3-nitrophenylboronic acid is also employed in chemical research as a starting material for the development of new synthetic methods and the exploration of novel chemical reactions. Its reactivity and functional groups make it a valuable tool for advancing the understanding of organic chemistry and its applications.
For example, 4-Amino-3-nitrophenylboronic acid is used as a reactant to prepare difluoromethoxy-3-nitrobiphenyl-4-amine by coupling with 1-bromo-2-(difluoromethoxy)-benzene in the presence of a palladium catalyst. This demonstrates its utility in the synthesis of specific target molecules through palladium-catalyzed coupling reactions.
Check Digit Verification of cas no
The CAS Registry Mumber 89466-07-9 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 8,9,4,6 and 6 respectively; the second part has 2 digits, 0 and 7 respectively.
Calculate Digit Verification of CAS Registry Number 89466-07:
(7*8)+(6*9)+(5*4)+(4*6)+(3*6)+(2*0)+(1*7)=179
179 % 10 = 9
So 89466-07-9 is a valid CAS Registry Number.
InChI:InChI=1/C6H7BN2O4/c8-5-2-1-4(7(10)11)3-6(5)9(12)13/h1-3,10-11H,8H2
