91914-07-7 Usage
General Description
2-Hydroxy-6-methylpyridine is a chemical compound with a molecular formula C6H7NO. It is a derivative of pyridine and contains a hydroxyl group and a methyl group. 2-HYDROXY-6-METHYLPYRIDINE is commonly used in the synthesis of pharmaceuticals, pesticides, and other organic compounds. It is also known for its ability to chelate metal ions, making it useful in various industrial and research applications. Additionally, 2-hydroxy-6-methylpyridine has been studied for its potential biological activities, including its antimicrobial and antitumor properties. Overall, this chemical compound has a wide range of uses and potential applications in different fields.
Check Digit Verification of cas no
The CAS Registry Mumber 91914-07-7 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 9,1,9,1 and 4 respectively; the second part has 2 digits, 0 and 7 respectively.
Calculate Digit Verification of CAS Registry Number 91914-07:
(7*9)+(6*1)+(5*9)+(4*1)+(3*4)+(2*0)+(1*7)=137
137 % 10 = 7
So 91914-07-7 is a valid CAS Registry Number.
InChI:InChI=1/C6H7NO/c1-5-3-2-4-6(8)7-5/h2-4H,1H3,(H,7,8)
