The tert-Butyl N-(3-amino-2,2-dimethylpropyl)carbamate with the cas number 292606-35-0 is also called Carbamicacid, N-(3-amino-2,2-dimethylpropyl)-, 1,1-dimethylethyl ester. Its molecular formula is C₁₀H₂₂N₂O₂. This chemical belongs to the following product categories: (1)N-BOC; (2)pharmacetical; (3)Monoprotected Diaminoalkanes; (4)N-Boc-diaminoalkanes.

The properties of the chemical are: (1)ACD/LogP: 1.46; (2)# of Rule of 5 Violations: 0; (3)ACD/LogD (pH 5.5): -1.63; (4)ACD/LogD (pH 7.4): -1.02; (5)ACD/BCF (pH 5.5): 1; (6)ACD/BCF (pH 7.4): 1; (7)ACD/KOC (pH 5.5): 1; (8)ACD/KOC (pH 7.4): 1; (9)#H bond acceptors: 4; (10)#H bond donors: 3; (11)#Freely Rotating Bonds: 6; (12)Polar Surface Area: 32.78 Å²; (13)Index of Refraction: 1.458; (14)Molar Refractivity: 57.21 cm³; (15)Molar Volume: 209.6 cm³; (16)Polarizability: 22.68×10^-24cm³; (17)Surface Tension: 32.8 dyne/cm; (18)Enthalpy of Vaporization: 53.34 kJ/mol; (19)Vapour Pressure: 0.00169 mmHg at 25°C.

You can still convert the following datas into molecular structure:
(1)SMILES: O=C(OC(C)(C)C)NCC(C)(C)CN
(2)InChI: InChI=1/C10H22N2O2/c1-9(2,3)14-8(13)12-7-10(4,5)6-11/h6-7,11H2,1-5H3,(H,12,13)
(3)InChIKey: QLPCQDZWRXWROH-UHFFFAOYAR