The 1,1-Cyclopentanedimethanol, with the CAS registry number 5763-53-1, is also known as 1,1-Bis(hydroxymethyl)cyclopentane. This chemical's molecular formula is C₇H₁₄O₂ and molecular weight is 130.18. Its IUPAC name and systematic name are the same which is called [1-(hydroxymethyl)cyclopentyl]methanol.

Physical properties of 1,1-Cyclopentanedimethanol: (1)ACD/LogP: 0.14 ; (2)#H bond acceptors: 2; (3)#H bond donors: 2; (4)#Freely Rotating Bonds: 4; (5)Polar Surface Area: 18.46 Å²; (6)Index of Refraction: 1.481; (7)Molar Refractivity: 35.42 cm³; (8)Molar Volume: 124.2 cm³; (9)Surface Tension: 47.7 dyne/cm; (10)Density: 1.047 g/cm³; (11)Flash Point: 124.4 °C; (12)Enthalpy of Vaporization: 57.53 kJ/mol; (13)Boiling Point: 257.7 °C at 760 mmHg; (14)Vapour Pressure: 0.00213 mmHg at 25°C.

Preparation: this chemical can be prepared by cyclopentane-1,1-dicarboxylic acid diethyl ester. This reaction will need reagent LiAlH₄.

Uses of 1,1-Cyclopentanedimethanol: it can be used to produce 1,1-Bis-hydroxymethyl-cyclopentan-ditosylat. This reaction will need reagent pyridine. The yield is about 59%.

You can still convert the following datas into molecular structure:
(1)Canonical SMILES: C1CCC(C1)(CO)CO
(2)InChI: InChI=1S/C7H14O2/c8-5-7(6-9)3-1-2-4-7/h8-9H,1-6H2
(3)InChIKey: OKSKZFYXWJAIIT-UHFFFAOYSA-N