41200-97-9 Usage
Description
1,5-Dichloro-2-(1-methylethoxy)-4-nitrobenzene is an organic compound characterized by its molecular structure that features two chlorine atoms at the 1st and 5th positions, a nitro group at the 4th position, and a 1-methylethoxy (isopropoxy) group at the 2nd position on a benzene ring. 1,5-dichloro-2-(1-methylethoxy)-4-nitrobenzene is known for its potential applications in various industries due to its unique chemical properties.
Uses
Used in Chemical Synthesis:
1,5-Dichloro-2-(1-methylethoxy)-4-nitrobenzene is used as an intermediate in the synthesis of various organic compounds, particularly in the pharmaceutical and agrochemical industries. Its unique structure allows for further functionalization and modification to create a range of products with specific applications.
Used in Pharmaceutical Industry:
In the pharmaceutical industry, 1,5-dichloro-2-(1-methylethoxy)-4-nitrobenzene is used as a building block for the development of new drugs. Its chemical properties make it a versatile starting material for the synthesis of various drug candidates, including those with potential therapeutic applications in treating various diseases and conditions.
Used in Agrochemical Industry:
1,5-Dichloro-2-(1-methylethoxy)-4-nitrobenzene is also utilized in the agrochemical industry for the synthesis of herbicides, insecticides, and other crop protection agents. Its chemical structure can be tailored to target specific pests or weeds, making it a valuable component in the development of effective and selective agrochemicals.
Used in Dye and Pigment Industry:
In the dye and pigment industry, 1,5-dichloro-2-(1-methylethoxy)-4-nitrobenzene can be used as a starting material for the synthesis of various dyes and pigments. Its unique chemical properties allow for the creation of colorants with specific color profiles and stability, making it a valuable asset in the development of new dyes and pigments for various applications, such as textiles, plastics, and printing inks.
Check Digit Verification of cas no
The CAS Registry Mumber 41200-97-9 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 4,1,2,0 and 0 respectively; the second part has 2 digits, 9 and 7 respectively.
Calculate Digit Verification of CAS Registry Number 41200-97:
(7*4)+(6*1)+(5*2)+(4*0)+(3*0)+(2*9)+(1*7)=69
69 % 10 = 9
So 41200-97-9 is a valid CAS Registry Number.
InChI:InChI=1/C9H9Cl2NO3/c1-5(2)15-9-4-8(12(13)14)6(10)3-7(9)11/h3-5H,1-2H3
41200-97-9Relevant articles and documents
Oxadiazon synthesis method
-
Paragraph 0016; 0037, (2017/06/02)
The invention discloses an oxadiazon synthesis method, wherein 2,4-dichloro-5-nitrophenol and 2-bromopropane are adopted as starting raw materials, and etherification, reduction, diazo reduction, acylation, light cyclization and other reaction process routes are performed to produce oxadiazon. The oxadiazon synthesis method has the following advantages that the operation process is convenient and the total yield is up to 99%; the raw materials are domestic and are easy to obtain, such that the raw material cost is easily reduced and the market competitiveness can be improved; and the solid phosgene is used to replace the hypertoxic phosgene used in the existing process, such that the reaction is stable and safe, the pollutant discharging during the production process is reduced, and the process is the environmentally friendly chemical industry process.
