The Pentanamide,N-cyclohexyl-, with the CAS registry number 2763-66-8, is also known as N-5-Chlorovaleryl cyclohexylamine. This chemical's molecular formula is C₁₁H₂₁NO and molecular weight is 183.2905. Its systematic name is called N-cyclohexylpentanamide.

Physical properties of Pentanamide,N-cyclohexyl-: (1)ACD/LogP: 2.60; (2)ACD/LogD (pH 5.5): 2.6; (3)ACD/LogD (pH 7.4): 2.6; (4)ACD/BCF (pH 5.5): 56.07; (5)ACD/BCF (pH 7.4): 56.07; (6)ACD/KOC (pH 5.5): 621.41; (7)ACD/KOC (pH 7.4): 621.41; (8)#H bond acceptors: 2; (9)#H bond donors: 1; (10)#Freely Rotating Bonds: 4; (11)Index of Refraction: 1.466; (12)Molar Refractivity: 54.67 cm³; (13)Molar Volume: 197.1 cm³; (14)Surface Tension: 32.9 dyne/cm; (15)Density: 0.92 g/cm³; (16)Flash Point: 198 °C; (17)Enthalpy of Vaporization: 57.53 kJ/mol; (18)Boiling Point: 332.6 °C at 760 mmHg; (19)Vapour Pressure: 0.000145 mmHg at 25°C.

You can still convert the following datas into molecular structure:
(1)SMILES: O=C(NC1CCCCC1)CCCC
(2)InChI: InChI=1/C11H21NO/c1-2-3-9-11(13)12-10-7-5-4-6-8-10/h10H,2-9H2,1H3,(H,12,13)
(3)InChIKey: JDGRQVUDURNFLX-UHFFFAOYAR