26673-32-5 Usage
Description
7-Chloro-1-tetralone, with the CAS number 26673-32-5, is a pale yellow to white crystalline powder that serves as a valuable research chemical. It is a derivative of tetralone, a type of organic compound, and is characterized by the presence of a chlorine atom at the 7th position.
Uses
Used in Research and Development:
7-Chloro-1-tetralone is used as a research chemical for various scientific applications. It plays a crucial role in the development and testing of new chemical compounds, pharmaceuticals, and materials. Its unique chemical properties make it a valuable tool in the field of organic chemistry and drug discovery.
Used in Pharmaceutical Industry:
In the pharmaceutical industry, 7-Chloro-1-tetralone is used as an intermediate or building block for the synthesis of various drugs and medications. Its specific chemical structure allows for the creation of new compounds with potential therapeutic applications, contributing to the advancement of medical treatments.
Used in Chemical Synthesis:
7-Chloro-1-tetralone is also utilized in chemical synthesis processes, where it serves as a key component in the production of other organic compounds. Its versatility and reactivity make it an essential ingredient in the creation of a wide range of chemical products, from dyes to agrochemicals.
Used in Material Science:
In the field of material science, 7-Chloro-1-tetralone is employed in the development of novel materials with specific properties. Its unique chemical structure can be used to create new polymers, coatings, and other materials with enhanced characteristics, such as improved strength, durability, or resistance to environmental factors.
Overall, 7-Chloro-1-tetralone is a versatile and valuable compound with a wide range of applications across various industries, including research and development, pharmaceuticals, chemical synthesis, and material science. Its unique properties and potential for further development make it an essential component in the ongoing pursuit of scientific and technological advancements.
Check Digit Verification of cas no
The CAS Registry Mumber 26673-32-5 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 2,6,6,7 and 3 respectively; the second part has 2 digits, 3 and 2 respectively.
Calculate Digit Verification of CAS Registry Number 26673-32:
(7*2)+(6*6)+(5*6)+(4*7)+(3*3)+(2*3)+(1*2)=125
125 % 10 = 5
So 26673-32-5 is a valid CAS Registry Number.
InChI:InChI=1/C10H9ClO/c11-8-5-4-7-2-1-3-10(12)9(7)6-8/h4-6H,1-3H2
26673-32-5Relevant articles and documents
Synthesis and structure-activity relationships of N-substituted spiropiperidines as nociceptin receptor ligands
Caldwell, John P.,Matasi, Julius J.,Zhang, Hongtao,Fawzi, Ahmad,Tulshian, Deen B.
, p. 2281 - 2284 (2007/10/03)
A series of N-substituted analogs based upon the spiropiperidine core of 1 was synthesized and exhibited high binding affinity to the nociceptin (NOP) receptor. The selectivities against other known opioid receptors were determined.
1-bolizazepin-2,5-diones
-
, (2008/06/13)
Benz[b]azepine compounds, pharmaceutical compositions containing them and methods for the treatment of neurological disorders utilizing them.
